C14H16BrF2NO — CID 82815478
N-[(3-bromocyclobutyl)methyl]-2,6-difluoro-N,3-dimethylbenzamide (PubChem CID 82815478) has the molecular formula C14H16BrF2NO and a molecular weight of 332.19 g/mol. Its IUPAC name is N-[(3-bromocyclobutyl)methyl]-2,6-difluoro-N,3-dimethylbenzamide.
| Compound Name | N-[(3-bromocyclobutyl)methyl]-2,6-difluoro-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 82815478 |
| Molecular Formula | C14H16BrF2NO |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-[(3-bromocyclobutyl)methyl]-2,6-difluoro-N,3-dimethylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)N(C)CC2CC(Br)C2)c1F |
| InChI | InChI=1S/C14H16BrF2NO/c1-8-3-4-11(16)12(13(8)17)14(19)18(2)7-9-5-10(15)6-9/h3-4,9-10H,5-7H2,1-2H3 |
| InChIKey | ZKFBNDJQVXHFKM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|