C15H20BrNO2 — CID 80676384
N-[(3-bromocyclobutyl)methyl]-3-methoxy-N,4-dimethylbenzamide (PubChem CID 80676384) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is N-[(3-bromocyclobutyl)methyl]-3-methoxy-N,4-dimethylbenzamide.
| Compound Name | N-[(3-bromocyclobutyl)methyl]-3-methoxy-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 80676384 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[(3-bromocyclobutyl)methyl]-3-methoxy-N,4-dimethylbenzamide |
| SMILES | COc1cc(C(=O)N(C)CC2CC(Br)C2)ccc1C |
| InChI | InChI=1S/C15H20BrNO2/c1-10-4-5-12(8-14(10)19-3)15(18)17(2)9-11-6-13(16)7-11/h4-5,8,11,13H,6-7,9H2,1-3H3 |
| InChIKey | FDMFQTFHMDRRQZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|