C17H16F2NO2P — CID 143972600
9-[difluoro(phosphanyl)methyl]-N-ethyl-9-hydroxyfluorene-2-carboxamide (PubChem CID 143972600) has the molecular formula C17H16F2NO2P and a molecular weight of 335.29 g/mol. Its IUPAC name is 9-[difluoro(phosphanyl)methyl]-N-ethyl-9-hydroxyfluorene-2-carboxamide.
| Compound Name | 9-[difluoro(phosphanyl)methyl]-N-ethyl-9-hydroxyfluorene-2-carboxamide |
|---|---|
| PubChem CID | 143972600 |
| Molecular Formula | C17H16F2NO2P |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 9-[difluoro(phosphanyl)methyl]-N-ethyl-9-hydroxyfluorene-2-carboxamide |
| SMILES | CCNC(=O)c1ccc2c(c1)C(O)(C(F)(F)P)c1ccccc1-2 |
| InChI | InChI=1S/C17H16F2NO2P/c1-2-20-15(21)10-7-8-12-11-5-3-4-6-13(11)16(22,14(12)9-10)17(18,19)23/h3-9,22H,2,23H2,1H3,(H,20,21) |
| InChIKey | KGVIFQKYANPKID-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|