C23H19ClF2NO2P — CID 143972670
2-chloro-4-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]-N,N-dimethylbenzamide (PubChem CID 143972670) has the molecular formula C23H19ClF2NO2P and a molecular weight of 445.83 g/mol. Its IUPAC name is 2-chloro-4-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]-N,N-dimethylbenzamide.
| Compound Name | 2-chloro-4-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 143972670 |
| Molecular Formula | C23H19ClF2NO2P |
| Molecular Weight | 445.83 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-chloro-4-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2ccc3c(c2)C(O)(C(F)(F)P)c2ccccc2-3)cc1Cl |
| InChI | InChI=1S/C23H19ClF2NO2P/c1-27(2)21(28)17-10-8-14(12-20(17)24)13-7-9-16-15-5-3-4-6-18(15)22(29,19(16)11-13)23(25,26)30/h3-12,29H,30H2,1-2H3 |
| InChIKey | BXNCMFIDJMBFAX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|