C20H22F2NO3P — CID 143972431
4-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]oxy-N,N-dimethylbutanamide (PubChem CID 143972431) has the molecular formula C20H22F2NO3P and a molecular weight of 393.37 g/mol. Its IUPAC name is 4-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]oxy-N,N-dimethylbutanamide.
| Compound Name | 4-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]oxy-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 143972431 |
| Molecular Formula | C20H22F2NO3P |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]oxy-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCOc1ccc2c(c1)C(O)(C(F)(F)P)c1ccccc1-2 |
| InChI | InChI=1S/C20H22F2NO3P/c1-23(2)18(24)8-5-11-26-13-9-10-15-14-6-3-4-7-16(14)19(25,17(15)12-13)20(21,22)27/h3-4,6-7,9-10,12,25H,5,8,11,27H2,1-2H3 |
| InChIKey | WVCTZAZOLJGJMP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|