C21H20F3NO3 — CID 162559119
1-[2-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl]piperidin-3-one (PubChem CID 162559119) has the molecular formula C21H20F3NO3 and a molecular weight of 391.39 g/mol. Its IUPAC name is 1-[2-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl]piperidin-3-one.
| Compound Name | 1-[2-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl]piperidin-3-one |
|---|---|
| PubChem CID | 162559119 |
| Molecular Formula | C21H20F3NO3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-[2-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl]piperidin-3-one |
| SMILES | O=C1CCCN(CCOc2ccc3c(c2)C(O)(C(F)(F)F)c2ccccc2-3)C1 |
| InChI | InChI=1S/C21H20F3NO3/c22-21(23,24)20(27)18-6-2-1-5-16(18)17-8-7-15(12-19(17)20)28-11-10-25-9-3-4-14(26)13-25/h1-2,5-8,12,27H,3-4,9-11,13H2 |
| InChIKey | ITFCHDCTZNWUBT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |