C20H19F3O4 — CID 59492967
6-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyhexanoic acid (PubChem CID 59492967) has the molecular formula C20H19F3O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is 6-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyhexanoic acid.
| Compound Name | 6-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 59492967 |
| Molecular Formula | C20H19F3O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 6-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccc2c(c1)C(O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C20H19F3O4/c21-20(22,23)19(26)16-7-4-3-6-14(16)15-10-9-13(12-17(15)19)27-11-5-1-2-8-18(24)25/h3-4,6-7,9-10,12,26H,1-2,5,8,11H2,(H,24,25) |
| InChIKey | JZDVRRMEAJFQCB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|