C22H23F2N2O3P — CID 143972382
9-[difluoro(phosphanyl)methyl]-2-[1-(2-hydroxyethyl)pyrazol-4-yl]-4-(2-hydroxypropan-2-yl)fluoren-9-ol (PubChem CID 143972382) has the molecular formula C22H23F2N2O3P and a molecular weight of 432.41 g/mol. Its IUPAC name is 9-[difluoro(phosphanyl)methyl]-2-[1-(2-hydroxyethyl)pyrazol-4-yl]-4-(2-hydroxypropan-2-yl)fluoren-9-ol.
| Compound Name | 9-[difluoro(phosphanyl)methyl]-2-[1-(2-hydroxyethyl)pyrazol-4-yl]-4-(2-hydroxypropan-2-yl)fluoren-9-ol |
|---|---|
| PubChem CID | 143972382 |
| Molecular Formula | C22H23F2N2O3P |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 9-[difluoro(phosphanyl)methyl]-2-[1-(2-hydroxyethyl)pyrazol-4-yl]-4-(2-hydroxypropan-2-yl)fluoren-9-ol |
| SMILES | CC(C)(O)c1cc(-c2cnn(CCO)c2)cc2c1-c1ccccc1C2(O)C(F)(F)P |
| InChI | InChI=1S/C22H23F2N2O3P/c1-20(2,28)17-9-13(14-11-25-26(12-14)7-8-27)10-18-19(17)15-5-3-4-6-16(15)21(18,29)22(23,24)30/h3-6,9-12,27-29H,7-8,30H2,1-2H3 |
| InChIKey | AYXGROOMSKIDMR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|