C23H20F3N3O3 — CID 59492486
9-hydroxy-N-(4-hydroxybutyl)-4-pyrimidin-5-yl-9-(trifluoromethyl)fluorene-2-carboxamide (PubChem CID 59492486) has the molecular formula C23H20F3N3O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is 9-hydroxy-N-(4-hydroxybutyl)-4-pyrimidin-5-yl-9-(trifluoromethyl)fluorene-2-carboxamide.
| Compound Name | 9-hydroxy-N-(4-hydroxybutyl)-4-pyrimidin-5-yl-9-(trifluoromethyl)fluorene-2-carboxamide |
|---|---|
| PubChem CID | 59492486 |
| Molecular Formula | C23H20F3N3O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 9-hydroxy-N-(4-hydroxybutyl)-4-pyrimidin-5-yl-9-(trifluoromethyl)fluorene-2-carboxamide |
| SMILES | O=C(NCCCCO)c1cc(-c2cncnc2)c2c(c1)C(O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C23H20F3N3O3/c24-23(25,26)22(32)18-6-2-1-5-16(18)20-17(15-11-27-13-28-12-15)9-14(10-19(20)22)21(31)29-7-3-4-8-30/h1-2,5-6,9-13,30,32H,3-4,7-8H2,(H,29,31) |
| InChIKey | AOWZXKOMZPQTSB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|