C24H17F4N5O2 — CID 171491118
2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-pyridin-2-ylacetohydrazide (PubChem CID 171491118) has the molecular formula C24H17F4N5O2 and a molecular weight of 483.43 g/mol. Its IUPAC name is 2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-pyridin-2-ylacetohydrazide.
| Compound Name | 2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-pyridin-2-ylacetohydrazide |
|---|---|
| PubChem CID | 171491118 |
| Molecular Formula | C24H17F4N5O2 |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-pyridin-2-ylacetohydrazide |
| SMILES | O=C(Cn1cc(-c2cc(F)cc3c2-c2ccccc2C3(O)C(F)(F)F)cn1)NNc1ccccn1 |
| InChI | InChI=1S/C24H17F4N5O2/c25-15-9-17(14-11-30-33(12-14)13-21(34)32-31-20-7-3-4-8-29-20)22-16-5-1-2-6-18(16)23(35,19(22)10-15)24(26,27)28/h1-12,35H,13H2,(H,29,31)(H,32,34) |
| InChIKey | FNZWGRFFPSUHIN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|