C27H22F4N4O4S — CID 171491129
2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-(4-methylsulfonylphenyl)propanehydrazide (PubChem CID 171491129) has the molecular formula C27H22F4N4O4S and a molecular weight of 574.56 g/mol. Its IUPAC name is 2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-(4-methylsulfonylphenyl)propanehydrazide.
| Compound Name | 2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-(4-methylsulfonylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 171491129 |
| Molecular Formula | C27H22F4N4O4S |
| Molecular Weight | 574.56 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-(4-methylsulfonylphenyl)propanehydrazide |
| SMILES | CC(C(=O)NNc1ccc(S(C)(=O)=O)cc1)n1cc(-c2cc(F)cc3c2-c2ccccc2C3(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C27H22F4N4O4S/c1-15(25(36)34-33-18-7-9-19(10-8-18)40(2,38)39)35-14-16(13-32-35)21-11-17(28)12-23-24(21)20-5-3-4-6-22(20)26(23,37)27(29,30)31/h3-15,33,37H,1-2H3,(H,34,36) |
| InChIKey | AHDMGRITDVDESW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|