C26H19F5N4O2 — CID 171491108
2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-(4-fluorophenyl)propanehydrazide (PubChem CID 171491108) has the molecular formula C26H19F5N4O2 and a molecular weight of 514.45 g/mol. Its IUPAC name is 2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-(4-fluorophenyl)propanehydrazide.
| Compound Name | 2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-(4-fluorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 171491108 |
| Molecular Formula | C26H19F5N4O2 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-[4-[2-fluoro-9-hydroxy-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]-N'-(4-fluorophenyl)propanehydrazide |
| SMILES | CC(C(=O)NNc1ccc(F)cc1)n1cc(-c2cc(F)cc3c2-c2ccccc2C3(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C26H19F5N4O2/c1-14(24(36)34-33-18-8-6-16(27)7-9-18)35-13-15(12-32-35)20-10-17(28)11-22-23(20)19-4-2-3-5-21(19)25(22,37)26(29,30)31/h2-14,33,37H,1H3,(H,34,36) |
| InChIKey | OKSSHJBHXKEVIK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|