C20H20F2NO2P — CID 143972525
[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]-(2-methylpyrrolidin-1-yl)methanone (PubChem CID 143972525) has the molecular formula C20H20F2NO2P and a molecular weight of 375.36 g/mol. Its IUPAC name is [9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]-(2-methylpyrrolidin-1-yl)methanone.
| Compound Name | [9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]-(2-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 143972525 |
| Molecular Formula | C20H20F2NO2P |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]-(2-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCCN1C(=O)c1ccc2c(c1)C(O)(C(F)(F)P)c1ccccc1-2 |
| InChI | InChI=1S/C20H20F2NO2P/c1-12-5-4-10-23(12)18(24)13-8-9-15-14-6-2-3-7-16(14)19(25,17(15)11-13)20(21,22)26/h2-3,6-9,11-12,25H,4-5,10,26H2,1H3 |
| InChIKey | AKXOYWXXSSXZLR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|