C16H22ClNO — CID 142238320
(4-tert-butyl-3-chlorophenyl)-(2-methylpyrrolidin-1-yl)methanone (PubChem CID 142238320) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is (4-tert-butyl-3-chlorophenyl)-(2-methylpyrrolidin-1-yl)methanone.
| Compound Name | (4-tert-butyl-3-chlorophenyl)-(2-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 142238320 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (4-tert-butyl-3-chlorophenyl)-(2-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCCN1C(=O)c1ccc(C(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C16H22ClNO/c1-11-6-5-9-18(11)15(19)12-7-8-13(14(17)10-12)16(2,3)4/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | KQSLIGPJVMOMSZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |