C13H15ClINO — CID 103734678
(3-chloro-4-iodophenyl)-(2-methylpiperidin-1-yl)methanone (PubChem CID 103734678) has the molecular formula C13H15ClINO and a molecular weight of 363.63 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(2-methylpiperidin-1-yl)methanone.
| Compound Name | (3-chloro-4-iodophenyl)-(2-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 103734678 |
| Molecular Formula | C13H15ClINO |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(2-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCCN1C(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClINO/c1-9-4-2-3-7-16(9)13(17)10-5-6-12(15)11(14)8-10/h5-6,8-9H,2-4,7H2,1H3 |
| InChIKey | HNNZPBMNTBBGFJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|