C14H14Cl2N2O — CID 94861983
2,6-dichloro-4-[(2S)-2-methylpiperidine-1-carbonyl]benzonitrile (PubChem CID 94861983) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is 2,6-dichloro-4-[(2S)-2-methylpiperidine-1-carbonyl]benzonitrile.
| Compound Name | 2,6-dichloro-4-[(2S)-2-methylpiperidine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 94861983 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2,6-dichloro-4-[(2S)-2-methylpiperidine-1-carbonyl]benzonitrile |
| SMILES | C[C@H]1CCCCN1C(=O)c1cc(Cl)c(C#N)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O/c1-9-4-2-3-5-18(9)14(19)10-6-12(15)11(8-17)13(16)7-10/h6-7,9H,2-5H2,1H3/t9-/m0/s1 |
| InChIKey | YRGJUKCSLDXFAE-VIFPVBQESA-N |
| XLogP | 3.88 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |