C14H14Cl2N2OS — CID 94861980
[2,6-dichloro-4-[(2R)-2-methylpiperidine-1-carbonyl]phenyl] thiocyanate (PubChem CID 94861980) has the molecular formula C14H14Cl2N2OS and a molecular weight of 329.25 g/mol. Its IUPAC name is [2,6-dichloro-4-[(2R)-2-methylpiperidine-1-carbonyl]phenyl] thiocyanate.
| Compound Name | [2,6-dichloro-4-[(2R)-2-methylpiperidine-1-carbonyl]phenyl] thiocyanate |
|---|---|
| PubChem CID | 94861980 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | [2,6-dichloro-4-[(2R)-2-methylpiperidine-1-carbonyl]phenyl] thiocyanate |
| SMILES | C[C@@H]1CCCCN1C(=O)c1cc(Cl)c(SC#N)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2OS/c1-9-4-2-3-5-18(9)14(19)10-6-11(15)13(20-8-17)12(16)7-10/h6-7,9H,2-5H2,1H3/t9-/m1/s1 |
| InChIKey | OLYNHPGDGDLFMG-SECBINFHSA-N |
| XLogP | 4.58 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|