C14H15ClINO3 — CID 106742259
1-(3-chloro-4-iodobenzoyl)-2-methylpiperidine-4-carboxylic acid (PubChem CID 106742259) has the molecular formula C14H15ClINO3 and a molecular weight of 407.64 g/mol. Its IUPAC name is 1-(3-chloro-4-iodobenzoyl)-2-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-(3-chloro-4-iodobenzoyl)-2-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106742259 |
| Molecular Formula | C14H15ClINO3 |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | 1-(3-chloro-4-iodobenzoyl)-2-methylpiperidine-4-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CCN1C(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H15ClINO3/c1-8-6-10(14(19)20)4-5-17(8)13(18)9-2-3-12(16)11(15)7-9/h2-3,7-8,10H,4-6H2,1H3,(H,19,20) |
| InChIKey | BZTOFBBLZYMRHU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|