C13H15ClINO2 — CID 103734967
(3-chloro-4-iodophenyl)-(2,5-dimethylmorpholin-4-yl)methanone (PubChem CID 103734967) has the molecular formula C13H15ClINO2 and a molecular weight of 379.63 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(2,5-dimethylmorpholin-4-yl)methanone.
| Compound Name | (3-chloro-4-iodophenyl)-(2,5-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 103734967 |
| Molecular Formula | C13H15ClINO2 |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(2,5-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(I)c(Cl)c2)C(C)CO1 |
| InChI | InChI=1S/C13H15ClINO2/c1-8-7-18-9(2)6-16(8)13(17)10-3-4-12(15)11(14)5-10/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | SXIFKKCXGSHPGL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|