C13H14ClIN2OS — CID 103220798
1-(3-chloro-4-iodobenzoyl)piperidine-2-carbothioamide (PubChem CID 103220798) has the molecular formula C13H14ClIN2OS and a molecular weight of 408.69 g/mol. Its IUPAC name is 1-(3-chloro-4-iodobenzoyl)piperidine-2-carbothioamide.
| Compound Name | 1-(3-chloro-4-iodobenzoyl)piperidine-2-carbothioamide |
|---|---|
| PubChem CID | 103220798 |
| Molecular Formula | C13H14ClIN2OS |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | 1-(3-chloro-4-iodobenzoyl)piperidine-2-carbothioamide |
| SMILES | NC(=S)C1CCCCN1C(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C13H14ClIN2OS/c14-9-7-8(4-5-10(9)15)13(18)17-6-2-1-3-11(17)12(16)19/h4-5,7,11H,1-3,6H2,(H2,16,19) |
| InChIKey | XGCVDOKLIORURN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|