C28H29F3O3 — CID 57201477
ethyl 5-[4-[4-[2-[3-(trifluoromethyl)phenyl]ethyl]phenyl]phenoxy]pentanoate (PubChem CID 57201477) has the molecular formula C28H29F3O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is ethyl 5-[4-[4-[2-[3-(trifluoromethyl)phenyl]ethyl]phenyl]phenoxy]pentanoate.
| Compound Name | ethyl 5-[4-[4-[2-[3-(trifluoromethyl)phenyl]ethyl]phenyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 57201477 |
| Molecular Formula | C28H29F3O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | ethyl 5-[4-[4-[2-[3-(trifluoromethyl)phenyl]ethyl]phenyl]phenoxy]pentanoate |
| SMILES | CCOC(=O)CCCCOc1ccc(-c2ccc(CCc3cccc(C(F)(F)F)c3)cc2)cc1 |
| InChI | InChI=1S/C28H29F3O3/c1-2-33-27(32)8-3-4-19-34-26-17-15-24(16-18-26)23-13-11-21(12-14-23)9-10-22-6-5-7-25(20-22)28(29,30)31/h5-7,11-18,20H,2-4,8-10,19H2,1H3 |
| InChIKey | JYQDXPMNBPQCRC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|