C27H34FN3O5 — CID 67127806
tert-butyl 2-[5-(4-ethoxycarbonylpiperidin-1-yl)-2-fluorophenyl]-5-methoxy-1,3-dihydrobenzimidazole-2-carboxylate (PubChem CID 67127806) has the molecular formula C27H34FN3O5 and a molecular weight of 499.58 g/mol. Its IUPAC name is tert-butyl 2-[5-(4-ethoxycarbonylpiperidin-1-yl)-2-fluorophenyl]-5-methoxy-1,3-dihydrobenzimidazole-2-carboxylate.
| Compound Name | tert-butyl 2-[5-(4-ethoxycarbonylpiperidin-1-yl)-2-fluorophenyl]-5-methoxy-1,3-dihydrobenzimidazole-2-carboxylate |
|---|---|
| PubChem CID | 67127806 |
| Molecular Formula | C27H34FN3O5 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | tert-butyl 2-[5-(4-ethoxycarbonylpiperidin-1-yl)-2-fluorophenyl]-5-methoxy-1,3-dihydrobenzimidazole-2-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(F)c(C3(C(=O)OC(C)(C)C)Nc4ccc(OC)cc4N3)c2)CC1 |
| InChI | InChI=1S/C27H34FN3O5/c1-6-35-24(32)17-11-13-31(14-12-17)18-7-9-21(28)20(15-18)27(25(33)36-26(2,3)4)29-22-10-8-19(34-5)16-23(22)30-27/h7-10,15-17,29-30H,6,11-14H2,1-5H3 |
| InChIKey | NRQSFXNOMMXZQB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|