C15H21NO4 — CID 83981205
ethyl 1-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylate (PubChem CID 83981205) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is ethyl 1-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 83981205 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | ethyl 1-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C15H21NO4/c1-4-20-15(17)11-7-8-16(10-11)12-5-6-13(18-2)14(9-12)19-3/h5-6,9,11H,4,7-8,10H2,1-3H3 |
| InChIKey | VAIBTFNDKCMXPZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|