C13H14Cl3NO2 — CID 67937102
ethyl 1-(3,4,5-trichlorophenyl)pyrrolidine-3-carboxylate (PubChem CID 67937102) has the molecular formula C13H14Cl3NO2 and a molecular weight of 322.62 g/mol. Its IUPAC name is ethyl 1-(3,4,5-trichlorophenyl)pyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-(3,4,5-trichlorophenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 67937102 |
| Molecular Formula | C13H14Cl3NO2 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | ethyl 1-(3,4,5-trichlorophenyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cc(Cl)c(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H14Cl3NO2/c1-2-19-13(18)8-3-4-17(7-8)9-5-10(14)12(16)11(15)6-9/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | FEFLGOXYMODBMX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|