C16H23NO3 — CID 83981248
4-[1-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]butan-2-one (PubChem CID 83981248) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-[1-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]butan-2-one.
| Compound Name | 4-[1-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]butan-2-one |
|---|---|
| PubChem CID | 83981248 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 4-[1-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]butan-2-one |
| SMILES | COc1ccc(N2CCC(CCC(C)=O)C2)cc1OC |
| InChI | InChI=1S/C16H23NO3/c1-12(18)4-5-13-8-9-17(11-13)14-6-7-15(19-2)16(10-14)20-3/h6-7,10,13H,4-5,8-9,11H2,1-3H3 |
| InChIKey | IIZQXAWVPSCZHP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|