C25H29N3O5S — CID 168623542
ethyl 2-[2-[2-[[3-[(3,4-diethoxyphenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168623542) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[3-[(3,4-diethoxyphenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[3-[(3,4-diethoxyphenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168623542 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | ethyl 2-[2-[2-[[3-[(3,4-diethoxyphenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cccc(OCc3ccc(OCC)c(OCC)c3)c2)n1 |
| InChI | InChI=1S/C25H29N3O5S/c1-4-30-22-11-10-19(13-23(22)31-5-2)16-33-21-9-7-8-18(12-21)15-26-28-25-27-20(17-34-25)14-24(29)32-6-3/h7-13,15,17H,4-6,14,16H2,1-3H3,(H,27,28) |
| InChIKey | UGQSKVOQBWOKBM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|