C23H23N3O6S — CID 168623645
4-[[4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 168623645) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is 4-[[4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 168623645 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 4-[[4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(OCc3ccc(C(=O)O)cc3)c(OC)c2)n1 |
| InChI | InChI=1S/C23H23N3O6S/c1-3-31-21(27)11-18-14-33-23(25-18)26-24-12-16-6-9-19(20(10-16)30-2)32-13-15-4-7-17(8-5-15)22(28)29/h4-10,12,14H,3,11,13H2,1-2H3,(H,25,26)(H,28,29) |
| InChIKey | JFNNYEJTJKACRJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|