C20H24ClN3O6S — CID 168624696
ethyl 2-[5-chloro-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]propanoate (PubChem CID 168624696) has the molecular formula C20H24ClN3O6S and a molecular weight of 469.95 g/mol. Its IUPAC name is ethyl 2-[5-chloro-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]propanoate.
| Compound Name | ethyl 2-[5-chloro-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 168624696 |
| Molecular Formula | C20H24ClN3O6S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | ethyl 2-[5-chloro-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]propanoate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc(OC)c(OC(C)C(=O)OCC)cc2Cl)n1 |
| InChI | InChI=1S/C20H24ClN3O6S/c1-5-28-18(25)8-14-11-31-20(23-14)24-22-10-13-7-16(27-4)17(9-15(13)21)30-12(3)19(26)29-6-2/h7,9-12H,5-6,8H2,1-4H3,(H,23,24) |
| InChIKey | BKTDQGHMGALXAW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|