C16H19ClN4O4S — CID 168627650
ethyl 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-chloro-2-methoxyphenoxy]propanoate (PubChem CID 168627650) has the molecular formula C16H19ClN4O4S and a molecular weight of 398.87 g/mol. Its IUPAC name is ethyl 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-chloro-2-methoxyphenoxy]propanoate.
| Compound Name | ethyl 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-chloro-2-methoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 168627650 |
| Molecular Formula | C16H19ClN4O4S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | ethyl 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-chloro-2-methoxyphenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1cc(Cl)c(C=NNc2nc(N)cs2)cc1OC |
| InChI | InChI=1S/C16H19ClN4O4S/c1-4-24-15(22)9(2)25-13-6-11(17)10(5-12(13)23-3)7-19-21-16-20-14(18)8-26-16/h5-9H,4,18H2,1-3H3,(H,20,21) |
| InChIKey | FBZPXENRAQKYBH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|