C13H14Cl2N4OS — CID 168627027
2-N-[(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627027) has the molecular formula C13H14Cl2N4OS and a molecular weight of 345.26 g/mol. Its IUPAC name is 2-N-[(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627027 |
| Molecular Formula | C13H14Cl2N4OS |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-N-[(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | CC(C)Oc1c(Cl)cc(C=NNc2nc(N)cs2)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N4OS/c1-7(2)20-12-9(14)3-8(4-10(12)15)5-17-19-13-18-11(16)6-21-13/h3-7H,16H2,1-2H3,(H,18,19) |
| InChIKey | QZLKPNDGQKQJRQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|