C16H19ClN4O4 — CID 168629945
2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]propanoic acid (PubChem CID 168629945) has the molecular formula C16H19ClN4O4 and a molecular weight of 366.81 g/mol. Its IUPAC name is 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]propanoic acid.
| Compound Name | 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 168629945 |
| Molecular Formula | C16H19ClN4O4 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]propanoic acid |
| SMILES | CCOc1cc(C=Nn2cc(C)nc2N)cc(Cl)c1OC(C)C(=O)O |
| InChI | InChI=1S/C16H19ClN4O4/c1-4-24-13-6-11(7-19-21-8-9(2)20-16(21)18)5-12(17)14(13)25-10(3)15(22)23/h5-8,10H,4H2,1-3H3,(H2,18,20)(H,22,23) |
| InChIKey | KTXJRUOTBSGXNN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|