C16H18ClN3O4S — CID 168618271
2-[2-chloro-6-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]propanoic acid (PubChem CID 168618271) has the molecular formula C16H18ClN3O4S and a molecular weight of 383.86 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 168618271 |
| Molecular Formula | C16H18ClN3O4S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]propanoic acid |
| SMILES | CCOc1cc(C=NNc2nc(C)cs2)cc(Cl)c1OC(C)C(=O)O |
| InChI | InChI=1S/C16H18ClN3O4S/c1-4-23-13-6-11(7-18-20-16-19-9(2)8-25-16)5-12(17)14(13)24-10(3)15(21)22/h5-8,10H,4H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | YWFYVGSXSXMAQF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|