C19H24ClN3O4S — CID 110531004
methyl 2-[(2Z)-2-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4-ethyl-1,3-thiazole-5-carboxylate (PubChem CID 110531004) has the molecular formula C19H24ClN3O4S and a molecular weight of 425.94 g/mol. Its IUPAC name is methyl 2-[(2Z)-2-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4-ethyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(2Z)-2-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4-ethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 110531004 |
| Molecular Formula | C19H24ClN3O4S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | methyl 2-[(2Z)-2-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4-ethyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOc1cc(/C=N\Nc2nc(CC)c(C(=O)OC)s2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C19H24ClN3O4S/c1-6-14-17(18(24)25-5)28-19(22-14)23-21-10-12-8-13(20)16(27-11(3)4)15(9-12)26-7-2/h8-11H,6-7H2,1-5H3,(H,22,23)/b21-10- |
| InChIKey | VFXSDCLYZDBJAV-FBHDLOMBSA-N |
| XLogP | 4.78 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|