C17H20BrN3O3S — CID 110530981
methyl 2-[(2Z)-2-[(3-bromo-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4-ethyl-1,3-thiazole-5-carboxylate (PubChem CID 110530981) has the molecular formula C17H20BrN3O3S and a molecular weight of 426.34 g/mol. Its IUPAC name is methyl 2-[(2Z)-2-[(3-bromo-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4-ethyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(2Z)-2-[(3-bromo-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4-ethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 110530981 |
| Molecular Formula | C17H20BrN3O3S |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | methyl 2-[(2Z)-2-[(3-bromo-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4-ethyl-1,3-thiazole-5-carboxylate |
| SMILES | CCc1nc(N/N=C\c2ccc(OC(C)C)c(Br)c2)sc1C(=O)OC |
| InChI | InChI=1S/C17H20BrN3O3S/c1-5-13-15(16(22)23-4)25-17(20-13)21-19-9-11-6-7-14(12(18)8-11)24-10(2)3/h6-10H,5H2,1-4H3,(H,20,21)/b19-9- |
| InChIKey | SSLTUYQWUOQDQB-OCKHKDLRSA-N |
| XLogP | 4.49 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|