C19H22Cl2N2O3 — CID 110505319
3-chloro-N-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-4-methoxyaniline (PubChem CID 110505319) has the molecular formula C19H22Cl2N2O3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 3-chloro-N-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-4-methoxyaniline.
| Compound Name | 3-chloro-N-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-4-methoxyaniline |
|---|---|
| PubChem CID | 110505319 |
| Molecular Formula | C19H22Cl2N2O3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 3-chloro-N-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-4-methoxyaniline |
| SMILES | CCOc1cc(/C=N/Nc2ccc(OC)c(Cl)c2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C19H22Cl2N2O3/c1-5-25-18-9-13(8-16(21)19(18)26-12(2)3)11-22-23-14-6-7-17(24-4)15(20)10-14/h6-12,23H,5H2,1-4H3/b22-11+ |
| InChIKey | DDAYFOIBRPMTQI-SSDVNMTOSA-N |
| XLogP | 5.63 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|