C15H16BrN3O3S — CID 168618661
[2-bromo-6-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] acetate (PubChem CID 168618661) has the molecular formula C15H16BrN3O3S and a molecular weight of 398.28 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [2-bromo-6-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 168618661 |
| Molecular Formula | C15H16BrN3O3S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] acetate |
| SMILES | CCOc1cc(C=NNc2nc(C)cs2)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C15H16BrN3O3S/c1-4-21-13-6-11(5-12(16)14(13)22-10(3)20)7-17-19-15-18-9(2)8-23-15/h5-8H,4H2,1-3H3,(H,18,19) |
| InChIKey | HMYPIQKUGNGKRY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|