C14H14Cl2N4O3 — CID 168629941
2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2,6-dichlorophenoxy]propanoic acid (PubChem CID 168629941) has the molecular formula C14H14Cl2N4O3 and a molecular weight of 357.20 g/mol. Its IUPAC name is 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2,6-dichlorophenoxy]propanoic acid.
| Compound Name | 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2,6-dichlorophenoxy]propanoic acid |
|---|---|
| PubChem CID | 168629941 |
| Molecular Formula | C14H14Cl2N4O3 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2,6-dichlorophenoxy]propanoic acid |
| SMILES | Cc1cn(N=Cc2cc(Cl)c(OC(C)C(=O)O)c(Cl)c2)c(N)n1 |
| InChI | InChI=1S/C14H14Cl2N4O3/c1-7-6-20(14(17)19-7)18-5-9-3-10(15)12(11(16)4-9)23-8(2)13(21)22/h3-6,8H,1-2H3,(H2,17,19)(H,21,22) |
| InChIKey | QXAYKDAUQFCLPK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|