C17H16N4 — CID 168628686
4-methyl-1-[(2-phenylphenyl)methylideneamino]imidazol-2-amine (PubChem CID 168628686) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-methyl-1-[(2-phenylphenyl)methylideneamino]imidazol-2-amine.
| Compound Name | 4-methyl-1-[(2-phenylphenyl)methylideneamino]imidazol-2-amine |
|---|---|
| PubChem CID | 168628686 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-methyl-1-[(2-phenylphenyl)methylideneamino]imidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccccc2-c2ccccc2)c(N)n1 |
| InChI | InChI=1S/C17H16N4/c1-13-12-21(17(18)20-13)19-11-15-9-5-6-10-16(15)14-7-3-2-4-8-14/h2-12H,1H3,(H2,18,20) |
| InChIKey | GYFHLTDVWRZHEP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|