C22H26N6 — CID 168629658
1-[[2-(4-benzylpiperazin-1-yl)phenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168629658) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-[[2-(4-benzylpiperazin-1-yl)phenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[2-(4-benzylpiperazin-1-yl)phenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168629658 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-[[2-(4-benzylpiperazin-1-yl)phenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccccc2N2CCN(Cc3ccccc3)CC2)c(N)n1 |
| InChI | InChI=1S/C22H26N6/c1-18-16-28(22(23)25-18)24-15-20-9-5-6-10-21(20)27-13-11-26(12-14-27)17-19-7-3-2-4-8-19/h2-10,15-16H,11-14,17H2,1H3,(H2,23,25) |
| InChIKey | YEFZXJZTYATRJO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|