C20H23N3O — CID 170876705
(Z)-3-[2-(4-benzylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 170876705) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is (Z)-3-[2-(4-benzylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-[2-(4-benzylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170876705 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (Z)-3-[2-(4-benzylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | NC(=O)/C=C\c1ccccc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N3O/c21-20(24)11-10-18-8-4-5-9-19(18)23-14-12-22(13-15-23)16-17-6-2-1-3-7-17/h1-11H,12-16H2,(H2,21,24)/b11-10- |
| InChIKey | UHFIMZOEEMGQHY-KHPPLWFESA-N |
| XLogP | 2.51 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|