C20H22BrN3O — CID 170878040
(E)-3-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]prop-2-enamide (PubChem CID 170878040) has the molecular formula C20H22BrN3O and a molecular weight of 400.32 g/mol. Its IUPAC name is (E)-3-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170878040 |
| Molecular Formula | C20H22BrN3O |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | (E)-3-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1ccc(N2CCN(Cc3ccccc3)CC2)cc1Br |
| InChI | InChI=1S/C20H22BrN3O/c21-19-14-18(8-6-17(19)7-9-20(22)25)24-12-10-23(11-13-24)15-16-4-2-1-3-5-16/h1-9,14H,10-13,15H2,(H2,22,25)/b9-7+ |
| InChIKey | CLFBCEKWSWNMJS-VQHVLOKHSA-N |
| XLogP | 3.27 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|