C20H26BrN3 — CID 113242044
1-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]propan-2-amine (PubChem CID 113242044) has the molecular formula C20H26BrN3 and a molecular weight of 388.35 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]propan-2-amine.
| Compound Name | 1-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]propan-2-amine |
|---|---|
| PubChem CID | 113242044 |
| Molecular Formula | C20H26BrN3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]propan-2-amine |
| SMILES | CC(N)Cc1ccc(N2CCN(Cc3ccccc3)CC2)cc1Br |
| InChI | InChI=1S/C20H26BrN3/c1-16(22)13-18-7-8-19(14-20(18)21)24-11-9-23(10-12-24)15-17-5-3-2-4-6-17/h2-8,14,16H,9-13,15,22H2,1H3 |
| InChIKey | VNLMSACZWAERDA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |