C21H28BrN3 — CID 113233595
1-[2-(4-benzylpiperazin-1-yl)-4-bromophenyl]butan-2-amine (PubChem CID 113233595) has the molecular formula C21H28BrN3 and a molecular weight of 402.38 g/mol. Its IUPAC name is 1-[2-(4-benzylpiperazin-1-yl)-4-bromophenyl]butan-2-amine.
| Compound Name | 1-[2-(4-benzylpiperazin-1-yl)-4-bromophenyl]butan-2-amine |
|---|---|
| PubChem CID | 113233595 |
| Molecular Formula | C21H28BrN3 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-[2-(4-benzylpiperazin-1-yl)-4-bromophenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(Br)cc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H28BrN3/c1-2-20(23)14-18-8-9-19(22)15-21(18)25-12-10-24(11-13-25)16-17-6-4-3-5-7-17/h3-9,15,20H,2,10-14,16,23H2,1H3 |
| InChIKey | AWAMEXMOBYHXCI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |