C21H29BrClN3 — CID 170890640
1-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]butan-2-amine;hydrochloride (PubChem CID 170890640) has the molecular formula C21H29BrClN3 and a molecular weight of 438.84 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170890640 |
| Molecular Formula | C21H29BrClN3 |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-[4-(4-benzylpiperazin-1-yl)-2-bromophenyl]butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1ccc(N2CCN(Cc3ccccc3)CC2)cc1Br.Cl |
| InChI | InChI=1S/C21H28BrN3.ClH/c1-2-19(23)14-18-8-9-20(15-21(18)22)25-12-10-24(11-13-25)16-17-6-4-3-5-7-17;/h3-9,15,19H,2,10-14,16,23H2,1H3;1H |
| InChIKey | VBWJBPMXDPCIGK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |