C20H22FN3O2 — CID 122514118
(E)-3-[2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 122514118) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is (E)-3-[2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 122514118 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (E)-3-[2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1N1CCN(Cc2ccccc2F)CC1)NO |
| InChI | InChI=1S/C20H22FN3O2/c21-18-7-3-1-6-17(18)15-23-11-13-24(14-12-23)19-8-4-2-5-16(19)9-10-20(25)22-26/h1-10,26H,11-15H2,(H,22,25)/b10-9+ |
| InChIKey | LXUNKKOPHRIZSF-MDZDMXLPSA-N |
| XLogP | 2.67 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|