C21H23ClFN3O4S — CID 122514160
(E)-3-[2-[4-[(4-chloro-2-fluorophenyl)methylsulfonylamino]piperidin-1-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 122514160) has the molecular formula C21H23ClFN3O4S and a molecular weight of 467.95 g/mol. Its IUPAC name is (E)-3-[2-[4-[(4-chloro-2-fluorophenyl)methylsulfonylamino]piperidin-1-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-[4-[(4-chloro-2-fluorophenyl)methylsulfonylamino]piperidin-1-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 122514160 |
| Molecular Formula | C21H23ClFN3O4S |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (E)-3-[2-[4-[(4-chloro-2-fluorophenyl)methylsulfonylamino]piperidin-1-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1N1CCC(NS(=O)(=O)Cc2ccc(Cl)cc2F)CC1)NO |
| InChI | InChI=1S/C21H23ClFN3O4S/c22-17-7-5-16(19(23)13-17)14-31(29,30)25-18-9-11-26(12-10-18)20-4-2-1-3-15(20)6-8-21(27)24-28/h1-8,13,18,25,28H,9-12,14H2,(H,24,27)/b8-6+ |
| InChIKey | KRAQTRBEARKTDE-SOFGYWHQSA-N |
| XLogP | 3.09 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|