C21H22FN3O3S — CID 122514032
(E)-3-[2-[4-[2-(4-fluorophenyl)sulfanylacetyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 122514032) has the molecular formula C21H22FN3O3S and a molecular weight of 415.49 g/mol. Its IUPAC name is (E)-3-[2-[4-[2-(4-fluorophenyl)sulfanylacetyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-[4-[2-(4-fluorophenyl)sulfanylacetyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 122514032 |
| Molecular Formula | C21H22FN3O3S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (E)-3-[2-[4-[2-(4-fluorophenyl)sulfanylacetyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1N1CCN(C(=O)CSc2ccc(F)cc2)CC1)NO |
| InChI | InChI=1S/C21H22FN3O3S/c22-17-6-8-18(9-7-17)29-15-21(27)25-13-11-24(12-14-25)19-4-2-1-3-16(19)5-10-20(26)23-28/h1-10,28H,11-15H2,(H,23,26)/b10-5+ |
| InChIKey | MEOHGYVLQXKFHT-BJMVGYQFSA-N |
| XLogP | 2.79 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|