C22H24N4O6S — CID 122513871
(E)-N-hydroxy-3-[2-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]piperidin-1-yl]phenyl]prop-2-enamide (PubChem CID 122513871) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[2-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]piperidin-1-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[2-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]piperidin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122513871 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (E)-N-hydroxy-3-[2-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]piperidin-1-yl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1N1CCC(NS(=O)(=O)c2ccc3c(c2)NC(=O)CO3)CC1)NO |
| InChI | InChI=1S/C22H24N4O6S/c27-21(24-29)8-5-15-3-1-2-4-19(15)26-11-9-16(10-12-26)25-33(30,31)17-6-7-20-18(13-17)23-22(28)14-32-20/h1-8,13,16,25,29H,9-12,14H2,(H,23,28)(H,24,27)/b8-5+ |
| InChIKey | KYBDHMYQZLSSGC-VMPITWQZSA-N |
| XLogP | 1.48 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|