C22H26F3N3O2 — CID 166920830
(E)-N-hydroxy-3-[2-[4-[[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methylamino]piperidin-1-yl]phenyl]prop-2-enamide (PubChem CID 166920830) has the molecular formula C22H26F3N3O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[2-[4-[[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methylamino]piperidin-1-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[2-[4-[[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methylamino]piperidin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166920830 |
| Molecular Formula | C22H26F3N3O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (E)-N-hydroxy-3-[2-[4-[[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methylamino]piperidin-1-yl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1N1CCC(NCC2=CCCC(C(F)(F)F)=C2)CC1)NO |
| InChI | InChI=1S/C22H26F3N3O2/c23-22(24,25)18-6-3-4-16(14-18)15-26-19-10-12-28(13-11-19)20-7-2-1-5-17(20)8-9-21(29)27-30/h1-2,4-5,7-9,14,19,26,30H,3,6,10-13,15H2,(H,27,29)/b9-8+ |
| InChIKey | ATUGATXSNKMEDI-CMDGGOBGSA-N |
| XLogP | 3.97 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|