C18H23N5O4S — CID 155210645
1-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-[(1-methylpyrazol-3-yl)-sulfinoamino]piperidine (PubChem CID 155210645) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-[(1-methylpyrazol-3-yl)-sulfinoamino]piperidine.
| Compound Name | 1-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-[(1-methylpyrazol-3-yl)-sulfinoamino]piperidine |
|---|---|
| PubChem CID | 155210645 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-[(1-methylpyrazol-3-yl)-sulfinoamino]piperidine |
| SMILES | Cn1ccc(N(C2CCN(c3ccccc3/C=C/C(=O)NO)CC2)S(=O)O)n1 |
| InChI | InChI=1S/C18H23N5O4S/c1-21-11-10-17(19-21)23(28(26)27)15-8-12-22(13-9-15)16-5-3-2-4-14(16)6-7-18(24)20-25/h2-7,10-11,15,25H,8-9,12-13H2,1H3,(H,20,24)(H,26,27)/b7-6+ |
| InChIKey | HOJKTZSNLCQGOS-VOTSOKGWSA-N |
| XLogP | 1.55 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|